C28H30Cl2N8O — CID 143489723
1-[(2-amino-5-chlorophenyl)methyl]-3-[(1S)-1-[5-chloro-4-(1H-indazol-6-yl)-1H-imidazol-2-yl]-3-phenylpropyl]urea;methanamine (PubChem CID 143489723) has the molecular formula C28H30Cl2N8O and a molecular weight of 565.51 g/mol. Its IUPAC name is 1-[(2-amino-5-chlorophenyl)methyl]-3-[(1S)-1-[5-chloro-4-(1H-indazol-6-yl)-1H-imidazol-2-yl]-3-phenylpropyl]urea;methanamine.
| Compound Name | 1-[(2-amino-5-chlorophenyl)methyl]-3-[(1S)-1-[5-chloro-4-(1H-indazol-6-yl)-1H-imidazol-2-yl]-3-phenylpropyl]urea;methanamine |
|---|---|
| PubChem CID | 143489723 |
| Molecular Formula | C28H30Cl2N8O |
| Molecular Weight | 565.51 g/mol |
| Exact Mass | 564.19 |
| IUPAC Name | 1-[(2-amino-5-chlorophenyl)methyl]-3-[(1S)-1-[5-chloro-4-(1H-indazol-6-yl)-1H-imidazol-2-yl]-3-phenylpropyl]urea;methanamine |
| SMILES | CN.Nc1ccc(Cl)cc1CNC(=O)N[C@@H](CCc1ccccc1)c1nc(-c2ccc3cn[nH]c3c2)c(Cl)[nH]1 |
| InChI | InChI=1S/C27H25Cl2N7O.CH5N/c28-20-9-10-21(30)19(12-20)14-31-27(37)33-22(11-6-16-4-2-1-3-5-16)26-34-24(25(29)35-26)17-7-8-18-15-32-36-23(18)13-17;1-2/h1-5,7-10,12-13,15,22H,6,11,14,30H2,(H,32,36)(H,34,35)(H2,31,33,37);2H2,1H3/t22-;/m0./s1 |
| InChIKey | ADPBSMMKOHPLLR-FTBISJDPSA-N |
| XLogP | 5.59 |
| TPSA | 150.53 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.51 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|