About butane;ethane;3-(4-methylphenyl)propanoic acid
butane;ethane;3-(4-methylphenyl)propanoic acid (PubChem CID 143489809) has the molecular formula C16H28O2
and a molecular weight of 252.40 g/mol. Its IUPAC name is butane;ethane;3-(4-methylphenyl)propanoic acid.
Molecular Properties
| Compound Name | butane;ethane;3-(4-methylphenyl)propanoic acid |
| PubChem CID | 143489809 |
| Molecular Formula | C16H28O2 |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.21 |
| IUPAC Name | butane;ethane;3-(4-methylphenyl)propanoic acid |
| SMILES | CC.CCCC.Cc1ccc(CCC(=O)O)cc1 |
| InChI | InChI=1S/C10H12O2.C4H10.C2H6/c1-8-2-4-9(5-3-8)6-7-10(11)12;1-3-4-2;1-2/h2-5H,6-7H2,1H3,(H,11,12);3-4H2,1-2H3;1-2H3 |
| InChIKey | YLDSGMLZRYBBPJ-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze butane;ethane;3-(4-methylphenyl)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane;ethane;3-(4-methylphenyl)propanoic acid?
The IUPAC name of butane;ethane;3-(4-methylphenyl)propanoic acid (CID 143489809) is butane;ethane;3-(4-methylphenyl)propanoic acid.
What is the SMILES notation for butane;ethane;3-(4-methylphenyl)propanoic acid?
The canonical SMILES for butane;ethane;3-(4-methylphenyl)propanoic acid is CC.CCCC.Cc1ccc(CCC(=O)O)cc1.
What is the InChIKey of butane;ethane;3-(4-methylphenyl)propanoic acid?
The InChIKey is YLDSGMLZRYBBPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O2.C4H10.C2H6/c1-8-2-4-9(5-3-8)6-7-10(11)12;1-3-4-2;1-2/h2-5H,6-7H2,1H3,(H,11,12);3-4H2,1-2H3;1-2H3.
What are the key properties of butane;ethane;3-(4-methylphenyl)propanoic acid?
butane;ethane;3-(4-methylphenyl)propanoic acid has a molecular weight of 252.40 g/mol, XLogP of 4.84, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for butane;ethane;3-(4-methylphenyl)propanoic acid is sourced from PubChem (CID 143489809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).