About 4,4-dimethyl-N-[[10-(methylaminomethyl)anthracen-9-yl]methyl]pent-1-en-2-amine;molecular hydrogen
4,4-dimethyl-N-[[10-(methylaminomethyl)anthracen-9-yl]methyl]pent-1-en-2-amine;molecular hydrogen (PubChem CID 143489836) has the molecular formula C24H34N2
and a molecular weight of 350.55 g/mol. Its IUPAC name is 4,4-dimethyl-N-[[10-(methylaminomethyl)anthracen-9-yl]methyl]pent-1-en-2-amine;molecular hydrogen.
Molecular Properties
| Compound Name | 4,4-dimethyl-N-[[10-(methylaminomethyl)anthracen-9-yl]methyl]pent-1-en-2-amine;molecular hydrogen |
| PubChem CID | 143489836 |
| Molecular Formula | C24H34N2 |
| Molecular Weight | 350.55 g/mol |
| Exact Mass | 350.27 |
| IUPAC Name | 4,4-dimethyl-N-[[10-(methylaminomethyl)anthracen-9-yl]methyl]pent-1-en-2-amine;molecular hydrogen |
| SMILES | C=C(CC(C)(C)C)NCc1c2ccccc2c(CNC)c2ccccc12.[H][H].[H][H] |
| InChI | InChI=1S/C24H30N2.2H2/c1-17(14-24(2,3)4)26-16-23-20-12-8-6-10-18(20)22(15-25-5)19-11-7-9-13-21(19)23;;/h6-13,25-26H,1,14-16H2,2-5H3;2*1H |
| InChIKey | VUUQIJUHEXUGMN-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 350.55 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 4,4-dimethyl-N-[[10-(methylaminomethyl)anthracen-9-yl]methyl]pent-1-en-2-amine;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-dimethyl-N-[[10-(methylaminomethyl)anthracen-9-yl]methyl]pent-1-en-2-amine;molecular hydrogen?
The IUPAC name of 4,4-dimethyl-N-[[10-(methylaminomethyl)anthracen-9-yl]methyl]pent-1-en-2-amine;molecular hydrogen (CID 143489836) is 4,4-dimethyl-N-[[10-(methylaminomethyl)anthracen-9-yl]methyl]pent-1-en-2-amine;molecular hydrogen.
What is the SMILES notation for 4,4-dimethyl-N-[[10-(methylaminomethyl)anthracen-9-yl]methyl]pent-1-en-2-amine;molecular hydrogen?
The canonical SMILES for 4,4-dimethyl-N-[[10-(methylaminomethyl)anthracen-9-yl]methyl]pent-1-en-2-amine;molecular hydrogen is C=C(CC(C)(C)C)NCc1c2ccccc2c(CNC)c2ccccc12.[H][H].[H][H].
What is the InChIKey of 4,4-dimethyl-N-[[10-(methylaminomethyl)anthracen-9-yl]methyl]pent-1-en-2-amine;molecular hydrogen?
The InChIKey is VUUQIJUHEXUGMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H30N2.2H2/c1-17(14-24(2,3)4)26-16-23-20-12-8-6-10-18(20)22(15-25-5)19-11-7-9-13-21(19)23;;/h6-13,25-26H,1,14-16H2,2-5H3;2*1H.
What are the key properties of 4,4-dimethyl-N-[[10-(methylaminomethyl)anthracen-9-yl]methyl]pent-1-en-2-amine;molecular hydrogen?
4,4-dimethyl-N-[[10-(methylaminomethyl)anthracen-9-yl]methyl]pent-1-en-2-amine;molecular hydrogen has a molecular weight of 350.55 g/mol, XLogP of 6.24, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-dimethyl-N-[[10-(methylaminomethyl)anthracen-9-yl]methyl]pent-1-en-2-amine;molecular hydrogen is sourced from PubChem (CID 143489836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).