About N'-[1-(4-fluorophenoxy)-6,8-dimethoxyisoquinolin-3-yl]-3-methylbut-2-enimidamide
N'-[1-(4-fluorophenoxy)-6,8-dimethoxyisoquinolin-3-yl]-3-methylbut-2-enimidamide (PubChem CID 143490222) has the molecular formula C22H22FN3O3
and a molecular weight of 395.43 g/mol. Its IUPAC name is N'-[1-(4-fluorophenoxy)-6,8-dimethoxyisoquinolin-3-yl]-3-methylbut-2-enimidamide.
Molecular Properties
| Compound Name | N'-[1-(4-fluorophenoxy)-6,8-dimethoxyisoquinolin-3-yl]-3-methylbut-2-enimidamide |
| PubChem CID | 143490222 |
| Molecular Formula | C22H22FN3O3 |
| Molecular Weight | 395.43 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | N'-[1-(4-fluorophenoxy)-6,8-dimethoxyisoquinolin-3-yl]-3-methylbut-2-enimidamide |
| SMILES | COc1cc(OC)c2c(Oc3ccc(F)cc3)nc(/N=C(/N)C=C(C)C)cc2c1 |
| InChI | InChI=1S/C22H22FN3O3/c1-13(2)9-19(24)25-20-11-14-10-17(27-3)12-18(28-4)21(14)22(26-20)29-16-7-5-15(23)6-8-16/h5-12H,1-4H3,(H2,24,25,26) |
| InChIKey | QDPBFFGUKSYLLC-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 78.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 395.43 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-[1-(4-fluorophenoxy)-6,8-dimethoxyisoquinolin-3-yl]-3-methylbut-2-enimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[1-(4-fluorophenoxy)-6,8-dimethoxyisoquinolin-3-yl]-3-methylbut-2-enimidamide?
The IUPAC name of N'-[1-(4-fluorophenoxy)-6,8-dimethoxyisoquinolin-3-yl]-3-methylbut-2-enimidamide (CID 143490222) is N'-[1-(4-fluorophenoxy)-6,8-dimethoxyisoquinolin-3-yl]-3-methylbut-2-enimidamide.
What is the SMILES notation for N'-[1-(4-fluorophenoxy)-6,8-dimethoxyisoquinolin-3-yl]-3-methylbut-2-enimidamide?
The canonical SMILES for N'-[1-(4-fluorophenoxy)-6,8-dimethoxyisoquinolin-3-yl]-3-methylbut-2-enimidamide is COc1cc(OC)c2c(Oc3ccc(F)cc3)nc(/N=C(/N)C=C(C)C)cc2c1.
What is the InChIKey of N'-[1-(4-fluorophenoxy)-6,8-dimethoxyisoquinolin-3-yl]-3-methylbut-2-enimidamide?
The InChIKey is QDPBFFGUKSYLLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22FN3O3/c1-13(2)9-19(24)25-20-11-14-10-17(27-3)12-18(28-4)21(14)22(26-20)29-16-7-5-15(23)6-8-16/h5-12H,1-4H3,(H2,24,25,26).
What are the key properties of N'-[1-(4-fluorophenoxy)-6,8-dimethoxyisoquinolin-3-yl]-3-methylbut-2-enimidamide?
N'-[1-(4-fluorophenoxy)-6,8-dimethoxyisoquinolin-3-yl]-3-methylbut-2-enimidamide has a molecular weight of 395.43 g/mol, XLogP of 5.14, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[1-(4-fluorophenoxy)-6,8-dimethoxyisoquinolin-3-yl]-3-methylbut-2-enimidamide is sourced from PubChem (CID 143490222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).