C10H11NO2 — CID 143490261
(2E)-2-hydroxyimino-3,5,6,7-tetrahydroazulen-1-one (PubChem CID 143490261) has the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. Its IUPAC name is (2E)-2-hydroxyimino-3,5,6,7-tetrahydroazulen-1-one.
| Compound Name | (2E)-2-hydroxyimino-3,5,6,7-tetrahydroazulen-1-one |
|---|---|
| PubChem CID | 143490261 |
| Molecular Formula | C10H11NO2 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.08 |
| IUPAC Name | (2E)-2-hydroxyimino-3,5,6,7-tetrahydroazulen-1-one |
| SMILES | O=C1C2=CCCCC=C2C/C1=N\O |
| InChI | InChI=1S/C10H11NO2/c12-10-8-5-3-1-2-4-7(8)6-9(10)11-13/h4-5,13H,1-3,6H2/b11-9+ |
| InChIKey | CSISYQBQCRZMCO-PKNBQFBNSA-N |
| XLogP | 1.83 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|