About ethane;2-methylprop-1-ene;N-(4-methylthiophen-3-yl)acetamide
ethane;2-methylprop-1-ene;N-(4-methylthiophen-3-yl)acetamide (PubChem CID 143490448) has the molecular formula C13H23NOS
and a molecular weight of 241.40 g/mol. Its IUPAC name is ethane;2-methylprop-1-ene;N-(4-methylthiophen-3-yl)acetamide.
Molecular Properties
| Compound Name | ethane;2-methylprop-1-ene;N-(4-methylthiophen-3-yl)acetamide |
| PubChem CID | 143490448 |
| Molecular Formula | C13H23NOS |
| Molecular Weight | 241.40 g/mol |
| Exact Mass | 241.15 |
| IUPAC Name | ethane;2-methylprop-1-ene;N-(4-methylthiophen-3-yl)acetamide |
| SMILES | C=C(C)C.CC.CC(=O)Nc1cscc1C |
| InChI | InChI=1S/C7H9NOS.C4H8.C2H6/c1-5-3-10-4-7(5)8-6(2)9;1-4(2)3;1-2/h3-4H,1-2H3,(H,8,9);1H2,2-3H3;1-2H3 |
| InChIKey | PXFYGZFVLQOSLC-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.40 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethane;2-methylprop-1-ene;N-(4-methylthiophen-3-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-methylprop-1-ene;N-(4-methylthiophen-3-yl)acetamide?
The IUPAC name of ethane;2-methylprop-1-ene;N-(4-methylthiophen-3-yl)acetamide (CID 143490448) is ethane;2-methylprop-1-ene;N-(4-methylthiophen-3-yl)acetamide.
What is the SMILES notation for ethane;2-methylprop-1-ene;N-(4-methylthiophen-3-yl)acetamide?
The canonical SMILES for ethane;2-methylprop-1-ene;N-(4-methylthiophen-3-yl)acetamide is C=C(C)C.CC.CC(=O)Nc1cscc1C.
What is the InChIKey of ethane;2-methylprop-1-ene;N-(4-methylthiophen-3-yl)acetamide?
The InChIKey is PXFYGZFVLQOSLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NOS.C4H8.C2H6/c1-5-3-10-4-7(5)8-6(2)9;1-4(2)3;1-2/h3-4H,1-2H3,(H,8,9);1H2,2-3H3;1-2H3.
What are the key properties of ethane;2-methylprop-1-ene;N-(4-methylthiophen-3-yl)acetamide?
ethane;2-methylprop-1-ene;N-(4-methylthiophen-3-yl)acetamide has a molecular weight of 241.40 g/mol, XLogP of 4.62, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-methylprop-1-ene;N-(4-methylthiophen-3-yl)acetamide is sourced from PubChem (CID 143490448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).