C30H38O4 — CID 143490657
formic acid;1-[3-[4-[3-methyl-4-(2-methylphenyl)phenoxy]butyl]phenyl]ethanone;propane (PubChem CID 143490657) has the molecular formula C30H38O4 and a molecular weight of 462.63 g/mol. Its IUPAC name is formic acid;1-[3-[4-[3-methyl-4-(2-methylphenyl)phenoxy]butyl]phenyl]ethanone;propane.
| Compound Name | formic acid;1-[3-[4-[3-methyl-4-(2-methylphenyl)phenoxy]butyl]phenyl]ethanone;propane |
|---|---|
| PubChem CID | 143490657 |
| Molecular Formula | C30H38O4 |
| Molecular Weight | 462.63 g/mol |
| Exact Mass | 462.28 |
| IUPAC Name | formic acid;1-[3-[4-[3-methyl-4-(2-methylphenyl)phenoxy]butyl]phenyl]ethanone;propane |
| SMILES | CC(=O)c1cccc(CCCCOc2ccc(-c3ccccc3C)c(C)c2)c1.CCC.O=CO |
| InChI | InChI=1S/C26H28O2.C3H8.CH2O2/c1-19-9-4-5-13-25(19)26-15-14-24(17-20(26)2)28-16-7-6-10-22-11-8-12-23(18-22)21(3)27;1-3-2;2-1-3/h4-5,8-9,11-15,17-18H,6-7,10,16H2,1-3H3;3H2,1-2H3;1H,(H,2,3) |
| InChIKey | ZXZHAGISIJULHN-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.63 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|