C14H14F15NO3 — CID 143490814
ethane;4-oxo-4-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctylamino)butanoic acid (PubChem CID 143490814) has the molecular formula C14H14F15NO3 and a molecular weight of 529.24 g/mol. Its IUPAC name is ethane;4-oxo-4-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctylamino)butanoic acid.
| Compound Name | ethane;4-oxo-4-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctylamino)butanoic acid |
|---|---|
| PubChem CID | 143490814 |
| Molecular Formula | C14H14F15NO3 |
| Molecular Weight | 529.24 g/mol |
| Exact Mass | 529.07 |
| IUPAC Name | ethane;4-oxo-4-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctylamino)butanoic acid |
| SMILES | CC.O=C(O)CCC(=O)NCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H8F15NO3.C2H6/c13-6(14,3-28-4(29)1-2-5(30)31)7(15,16)8(17,18)9(19,20)10(21,22)11(23,24)12(25,26)27;1-2/h1-3H2,(H,28,29)(H,30,31);1-2H3 |
| InChIKey | DGMZCHHEYIVAIC-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.24 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|