C14H13F14NO3 — CID 143490817
(2R,3R)-2,3-dimethyl-4-oxo-4-(2,2,3,3,4,4,5,5,6,6,7,7,8,8-tetradecafluorooctylamino)butanoic acid (PubChem CID 143490817) has the molecular formula C14H13F14NO3 and a molecular weight of 509.23 g/mol. Its IUPAC name is (2R,3R)-2,3-dimethyl-4-oxo-4-(2,2,3,3,4,4,5,5,6,6,7,7,8,8-tetradecafluorooctylamino)butanoic acid.
| Compound Name | (2R,3R)-2,3-dimethyl-4-oxo-4-(2,2,3,3,4,4,5,5,6,6,7,7,8,8-tetradecafluorooctylamino)butanoic acid |
|---|---|
| PubChem CID | 143490817 |
| Molecular Formula | C14H13F14NO3 |
| Molecular Weight | 509.23 g/mol |
| Exact Mass | 509.07 |
| IUPAC Name | (2R,3R)-2,3-dimethyl-4-oxo-4-(2,2,3,3,4,4,5,5,6,6,7,7,8,8-tetradecafluorooctylamino)butanoic acid |
| SMILES | C[C@@H](C(=O)O)[C@@H](C)C(=O)NCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C14H13F14NO3/c1-4(5(2)7(31)32)6(30)29-3-9(17,18)11(21,22)13(25,26)14(27,28)12(23,24)10(19,20)8(15)16/h4-5,8H,3H2,1-2H3,(H,29,30)(H,31,32)/t4-,5-/m1/s1 |
| InChIKey | IQRZAKCPJUZFFO-RFZPGFLSSA-N |
| XLogP | 4.54 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.23 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|