C13H12F14NO3P — CID 143490861
4-oxo-4-[(2,3,3,4,4,5,5,6,6,7,7,9,9,9-tetradecafluoro-2-phosphanylnonyl)amino]butanoic acid (PubChem CID 143490861) has the molecular formula C13H12F14NO3P and a molecular weight of 527.19 g/mol. Its IUPAC name is 4-oxo-4-[(2,3,3,4,4,5,5,6,6,7,7,9,9,9-tetradecafluoro-2-phosphanylnonyl)amino]butanoic acid.
| Compound Name | 4-oxo-4-[(2,3,3,4,4,5,5,6,6,7,7,9,9,9-tetradecafluoro-2-phosphanylnonyl)amino]butanoic acid |
|---|---|
| PubChem CID | 143490861 |
| Molecular Formula | C13H12F14NO3P |
| Molecular Weight | 527.19 g/mol |
| Exact Mass | 527.03 |
| IUPAC Name | 4-oxo-4-[(2,3,3,4,4,5,5,6,6,7,7,9,9,9-tetradecafluoro-2-phosphanylnonyl)amino]butanoic acid |
| SMILES | O=C(O)CCC(=O)NCC(F)(P)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CC(F)(F)F |
| InChI | InChI=1S/C13H12F14NO3P/c14-7(15,3-9(17,18)19)10(20,21)12(24,25)13(26,27)11(22,23)8(16,32)4-28-5(29)1-2-6(30)31/h1-4,32H2,(H,28,29)(H,30,31) |
| InChIKey | PYNUZCOHMANDGK-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.19 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|