About 6-cyclopenta-1,3-dien-1-yl-7-iminoundecan-3-one
6-cyclopenta-1,3-dien-1-yl-7-iminoundecan-3-one (PubChem CID 143491204) has the molecular formula C16H25NO
and a molecular weight of 247.38 g/mol. Its IUPAC name is 6-cyclopenta-1,3-dien-1-yl-7-iminoundecan-3-one.
Molecular Properties
| Compound Name | 6-cyclopenta-1,3-dien-1-yl-7-iminoundecan-3-one |
| PubChem CID | 143491204 |
| Molecular Formula | C16H25NO |
| Molecular Weight | 247.38 g/mol |
| Exact Mass | 247.19 |
| IUPAC Name | 6-cyclopenta-1,3-dien-1-yl-7-iminoundecan-3-one |
| SMILES | [H]/N=C(\CCCC)C(CCC(=O)CC)C1=CC=CC1 |
| InChI | InChI=1S/C16H25NO/c1-3-5-10-16(17)15(12-11-14(18)4-2)13-8-6-7-9-13/h6-8,15,17H,3-5,9-12H2,1-2H3/b17-16+ |
| InChIKey | ADNLGCKUKMSMSU-WUKNDPDISA-N |
| XLogP | 4.46 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.38 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 6-cyclopenta-1,3-dien-1-yl-7-iminoundecan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-cyclopenta-1,3-dien-1-yl-7-iminoundecan-3-one?
The IUPAC name of 6-cyclopenta-1,3-dien-1-yl-7-iminoundecan-3-one (CID 143491204) is 6-cyclopenta-1,3-dien-1-yl-7-iminoundecan-3-one.
What is the SMILES notation for 6-cyclopenta-1,3-dien-1-yl-7-iminoundecan-3-one?
The canonical SMILES for 6-cyclopenta-1,3-dien-1-yl-7-iminoundecan-3-one is [H]/N=C(\CCCC)C(CCC(=O)CC)C1=CC=CC1.
What is the InChIKey of 6-cyclopenta-1,3-dien-1-yl-7-iminoundecan-3-one?
The InChIKey is ADNLGCKUKMSMSU-WUKNDPDISA-N. The full InChI is InChI=1S/C16H25NO/c1-3-5-10-16(17)15(12-11-14(18)4-2)13-8-6-7-9-13/h6-8,15,17H,3-5,9-12H2,1-2H3/b17-16+.
What are the key properties of 6-cyclopenta-1,3-dien-1-yl-7-iminoundecan-3-one?
6-cyclopenta-1,3-dien-1-yl-7-iminoundecan-3-one has a molecular weight of 247.38 g/mol, XLogP of 4.46, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-cyclopenta-1,3-dien-1-yl-7-iminoundecan-3-one is sourced from PubChem (CID 143491204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).