About 2,3-bis(ethenyl)-1,4-dimethyl-2H-pyridine;ethane
2,3-bis(ethenyl)-1,4-dimethyl-2H-pyridine;ethane (PubChem CID 143491336) has the molecular formula C13H21N
and a molecular weight of 191.32 g/mol. Its IUPAC name is 2,3-bis(ethenyl)-1,4-dimethyl-2H-pyridine;ethane.
Molecular Properties
| Compound Name | 2,3-bis(ethenyl)-1,4-dimethyl-2H-pyridine;ethane |
| PubChem CID | 143491336 |
| Molecular Formula | C13H21N |
| Molecular Weight | 191.32 g/mol |
| Exact Mass | 191.17 |
| IUPAC Name | 2,3-bis(ethenyl)-1,4-dimethyl-2H-pyridine;ethane |
| SMILES | C=CC1=C(C)C=CN(C)C1C=C.CC |
| InChI | InChI=1S/C11H15N.C2H6/c1-5-10-9(3)7-8-12(4)11(10)6-2;1-2/h5-8,11H,1-2H2,3-4H3;1-2H3 |
| InChIKey | GESPBQLLJAENPN-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.32 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2,3-bis(ethenyl)-1,4-dimethyl-2H-pyridine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-bis(ethenyl)-1,4-dimethyl-2H-pyridine;ethane?
The IUPAC name of 2,3-bis(ethenyl)-1,4-dimethyl-2H-pyridine;ethane (CID 143491336) is 2,3-bis(ethenyl)-1,4-dimethyl-2H-pyridine;ethane.
What is the SMILES notation for 2,3-bis(ethenyl)-1,4-dimethyl-2H-pyridine;ethane?
The canonical SMILES for 2,3-bis(ethenyl)-1,4-dimethyl-2H-pyridine;ethane is C=CC1=C(C)C=CN(C)C1C=C.CC.
What is the InChIKey of 2,3-bis(ethenyl)-1,4-dimethyl-2H-pyridine;ethane?
The InChIKey is GESPBQLLJAENPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N.C2H6/c1-5-10-9(3)7-8-12(4)11(10)6-2;1-2/h5-8,11H,1-2H2,3-4H3;1-2H3.
What are the key properties of 2,3-bis(ethenyl)-1,4-dimethyl-2H-pyridine;ethane?
2,3-bis(ethenyl)-1,4-dimethyl-2H-pyridine;ethane has a molecular weight of 191.32 g/mol, XLogP of 3.53, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-bis(ethenyl)-1,4-dimethyl-2H-pyridine;ethane is sourced from PubChem (CID 143491336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).