C11H17NO — CID 143491913
4-[(Z)-but-1-enyl]-5-methyl-1,2,3,6-tetrahydropyridine-2-carbaldehyde (PubChem CID 143491913) has the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. Its IUPAC name is 4-[(Z)-but-1-enyl]-5-methyl-1,2,3,6-tetrahydropyridine-2-carbaldehyde.
| Compound Name | 4-[(Z)-but-1-enyl]-5-methyl-1,2,3,6-tetrahydropyridine-2-carbaldehyde |
|---|---|
| PubChem CID | 143491913 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | 4-[(Z)-but-1-enyl]-5-methyl-1,2,3,6-tetrahydropyridine-2-carbaldehyde |
| SMILES | CC/C=C\C1=C(C)CNC(C=O)C1 |
| InChI | InChI=1S/C11H17NO/c1-3-4-5-10-6-11(8-13)12-7-9(10)2/h4-5,8,11-12H,3,6-7H2,1-2H3/b5-4- |
| InChIKey | WPGTWBQXSUAEJQ-PLNGDYQASA-N |
| XLogP | 1.83 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|