About [4-(3,4-dichlorophenyl)piperazin-1-yl]-piperazin-2-ylmethanone;ethane
[4-(3,4-dichlorophenyl)piperazin-1-yl]-piperazin-2-ylmethanone;ethane (PubChem CID 143492010) has the molecular formula C17H26Cl2N4O
and a molecular weight of 373.33 g/mol. Its IUPAC name is [4-(3,4-dichlorophenyl)piperazin-1-yl]-piperazin-2-ylmethanone;ethane.
Molecular Properties
| Compound Name | [4-(3,4-dichlorophenyl)piperazin-1-yl]-piperazin-2-ylmethanone;ethane |
| PubChem CID | 143492010 |
| Molecular Formula | C17H26Cl2N4O |
| Molecular Weight | 373.33 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | [4-(3,4-dichlorophenyl)piperazin-1-yl]-piperazin-2-ylmethanone;ethane |
| SMILES | CC.O=C(C1CNCCN1)N1CCN(c2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C15H20Cl2N4O.C2H6/c16-12-2-1-11(9-13(12)17)20-5-7-21(8-6-20)15(22)14-10-18-3-4-19-14;1-2/h1-2,9,14,18-19H,3-8,10H2;1-2H3 |
| InChIKey | UFDVJSUYNQMPIH-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.33 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [4-(3,4-dichlorophenyl)piperazin-1-yl]-piperazin-2-ylmethanone;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(3,4-dichlorophenyl)piperazin-1-yl]-piperazin-2-ylmethanone;ethane?
The IUPAC name of [4-(3,4-dichlorophenyl)piperazin-1-yl]-piperazin-2-ylmethanone;ethane (CID 143492010) is [4-(3,4-dichlorophenyl)piperazin-1-yl]-piperazin-2-ylmethanone;ethane.
What is the SMILES notation for [4-(3,4-dichlorophenyl)piperazin-1-yl]-piperazin-2-ylmethanone;ethane?
The canonical SMILES for [4-(3,4-dichlorophenyl)piperazin-1-yl]-piperazin-2-ylmethanone;ethane is CC.O=C(C1CNCCN1)N1CCN(c2ccc(Cl)c(Cl)c2)CC1.
What is the InChIKey of [4-(3,4-dichlorophenyl)piperazin-1-yl]-piperazin-2-ylmethanone;ethane?
The InChIKey is UFDVJSUYNQMPIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20Cl2N4O.C2H6/c16-12-2-1-11(9-13(12)17)20-5-7-21(8-6-20)15(22)14-10-18-3-4-19-14;1-2/h1-2,9,14,18-19H,3-8,10H2;1-2H3.
What are the key properties of [4-(3,4-dichlorophenyl)piperazin-1-yl]-piperazin-2-ylmethanone;ethane?
[4-(3,4-dichlorophenyl)piperazin-1-yl]-piperazin-2-ylmethanone;ethane has a molecular weight of 373.33 g/mol, XLogP of 2.23, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(3,4-dichlorophenyl)piperazin-1-yl]-piperazin-2-ylmethanone;ethane is sourced from PubChem (CID 143492010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).