About 4-[3-[(3,4-dichlorophenyl)methyl]-6-methoxyquinolin-4-yl]morpholine
4-[3-[(3,4-dichlorophenyl)methyl]-6-methoxyquinolin-4-yl]morpholine (PubChem CID 143492312) has the molecular formula C21H20Cl2N2O2
and a molecular weight of 403.31 g/mol. Its IUPAC name is 4-[3-[(3,4-dichlorophenyl)methyl]-6-methoxyquinolin-4-yl]morpholine.
Molecular Properties
| Compound Name | 4-[3-[(3,4-dichlorophenyl)methyl]-6-methoxyquinolin-4-yl]morpholine |
| PubChem CID | 143492312 |
| Molecular Formula | C21H20Cl2N2O2 |
| Molecular Weight | 403.31 g/mol |
| Exact Mass | 402.09 |
| IUPAC Name | 4-[3-[(3,4-dichlorophenyl)methyl]-6-methoxyquinolin-4-yl]morpholine |
| SMILES | COc1ccc2ncc(Cc3ccc(Cl)c(Cl)c3)c(N3CCOCC3)c2c1 |
| InChI | InChI=1S/C21H20Cl2N2O2/c1-26-16-3-5-20-17(12-16)21(25-6-8-27-9-7-25)15(13-24-20)10-14-2-4-18(22)19(23)11-14/h2-5,11-13H,6-10H2,1H3 |
| InChIKey | DSPKJOKPOKMVMZ-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.31 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[3-[(3,4-dichlorophenyl)methyl]-6-methoxyquinolin-4-yl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-[(3,4-dichlorophenyl)methyl]-6-methoxyquinolin-4-yl]morpholine?
The IUPAC name of 4-[3-[(3,4-dichlorophenyl)methyl]-6-methoxyquinolin-4-yl]morpholine (CID 143492312) is 4-[3-[(3,4-dichlorophenyl)methyl]-6-methoxyquinolin-4-yl]morpholine.
What is the SMILES notation for 4-[3-[(3,4-dichlorophenyl)methyl]-6-methoxyquinolin-4-yl]morpholine?
The canonical SMILES for 4-[3-[(3,4-dichlorophenyl)methyl]-6-methoxyquinolin-4-yl]morpholine is COc1ccc2ncc(Cc3ccc(Cl)c(Cl)c3)c(N3CCOCC3)c2c1.
What is the InChIKey of 4-[3-[(3,4-dichlorophenyl)methyl]-6-methoxyquinolin-4-yl]morpholine?
The InChIKey is DSPKJOKPOKMVMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20Cl2N2O2/c1-26-16-3-5-20-17(12-16)21(25-6-8-27-9-7-25)15(13-24-20)10-14-2-4-18(22)19(23)11-14/h2-5,11-13H,6-10H2,1H3.
What are the key properties of 4-[3-[(3,4-dichlorophenyl)methyl]-6-methoxyquinolin-4-yl]morpholine?
4-[3-[(3,4-dichlorophenyl)methyl]-6-methoxyquinolin-4-yl]morpholine has a molecular weight of 403.31 g/mol, XLogP of 4.98, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-[(3,4-dichlorophenyl)methyl]-6-methoxyquinolin-4-yl]morpholine is sourced from PubChem (CID 143492312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).