About [3,5,5-trimethyl-2-oxo-4-[(E)-3-oxobut-1-enyl]cyclohex-3-en-1-yl] acetate
[3,5,5-trimethyl-2-oxo-4-[(E)-3-oxobut-1-enyl]cyclohex-3-en-1-yl] acetate (PubChem CID 143492815) has the molecular formula C15H20O4
and a molecular weight of 264.32 g/mol. Its IUPAC name is [3,5,5-trimethyl-2-oxo-4-[(E)-3-oxobut-1-enyl]cyclohex-3-en-1-yl] acetate.
Molecular Properties
| Compound Name | [3,5,5-trimethyl-2-oxo-4-[(E)-3-oxobut-1-enyl]cyclohex-3-en-1-yl] acetate |
| PubChem CID | 143492815 |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | [3,5,5-trimethyl-2-oxo-4-[(E)-3-oxobut-1-enyl]cyclohex-3-en-1-yl] acetate |
| SMILES | CC(=O)/C=C/C1=C(C)C(=O)C(OC(C)=O)CC1(C)C |
| InChI | InChI=1S/C15H20O4/c1-9(16)6-7-12-10(2)14(18)13(19-11(3)17)8-15(12,4)5/h6-7,13H,8H2,1-5H3/b7-6+ |
| InChIKey | BATPQHLSSCDHFO-VOTSOKGWSA-N |
| XLogP | 2.38 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [3,5,5-trimethyl-2-oxo-4-[(E)-3-oxobut-1-enyl]cyclohex-3-en-1-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3,5,5-trimethyl-2-oxo-4-[(E)-3-oxobut-1-enyl]cyclohex-3-en-1-yl] acetate?
The IUPAC name of [3,5,5-trimethyl-2-oxo-4-[(E)-3-oxobut-1-enyl]cyclohex-3-en-1-yl] acetate (CID 143492815) is [3,5,5-trimethyl-2-oxo-4-[(E)-3-oxobut-1-enyl]cyclohex-3-en-1-yl] acetate.
What is the SMILES notation for [3,5,5-trimethyl-2-oxo-4-[(E)-3-oxobut-1-enyl]cyclohex-3-en-1-yl] acetate?
The canonical SMILES for [3,5,5-trimethyl-2-oxo-4-[(E)-3-oxobut-1-enyl]cyclohex-3-en-1-yl] acetate is CC(=O)/C=C/C1=C(C)C(=O)C(OC(C)=O)CC1(C)C.
What is the InChIKey of [3,5,5-trimethyl-2-oxo-4-[(E)-3-oxobut-1-enyl]cyclohex-3-en-1-yl] acetate?
The InChIKey is BATPQHLSSCDHFO-VOTSOKGWSA-N. The full InChI is InChI=1S/C15H20O4/c1-9(16)6-7-12-10(2)14(18)13(19-11(3)17)8-15(12,4)5/h6-7,13H,8H2,1-5H3/b7-6+.
What are the key properties of [3,5,5-trimethyl-2-oxo-4-[(E)-3-oxobut-1-enyl]cyclohex-3-en-1-yl] acetate?
[3,5,5-trimethyl-2-oxo-4-[(E)-3-oxobut-1-enyl]cyclohex-3-en-1-yl] acetate has a molecular weight of 264.32 g/mol, XLogP of 2.38, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3,5,5-trimethyl-2-oxo-4-[(E)-3-oxobut-1-enyl]cyclohex-3-en-1-yl] acetate is sourced from PubChem (CID 143492815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).