C33H44ClN2+ — CID 143492897
(2E)-2-[(2E)-2-[3-[(E)-2-[4,5-bis(ethenyl)-1,3,3-trimethylpyrrol-1-ium-2-yl]ethenyl]-2-chlorocyclopent-2-en-1-ylidene]ethylidene]-1,3,3-trimethyl-5,6-dihydroindole;ethane (PubChem CID 143492897) has the molecular formula C33H44ClN2+ and a molecular weight of 504.18 g/mol. Its IUPAC name is (2E)-2-[(2E)-2-[3-[(E)-2-[4,5-bis(ethenyl)-1,3,3-trimethylpyrrol-1-ium-2-yl]ethenyl]-2-chlorocyclopent-2-en-1-ylidene]ethylidene]-1,3,3-trimethyl-5,6-dihydroindole;ethane.
| Compound Name | (2E)-2-[(2E)-2-[3-[(E)-2-[4,5-bis(ethenyl)-1,3,3-trimethylpyrrol-1-ium-2-yl]ethenyl]-2-chlorocyclopent-2-en-1-ylidene]ethylidene]-1,3,3-trimethyl-5,6-dihydroindole;ethane |
|---|---|
| PubChem CID | 143492897 |
| Molecular Formula | C33H44ClN2+ |
| Molecular Weight | 504.18 g/mol |
| Exact Mass | 503.32 |
| IUPAC Name | (2E)-2-[(2E)-2-[3-[(E)-2-[4,5-bis(ethenyl)-1,3,3-trimethylpyrrol-1-ium-2-yl]ethenyl]-2-chlorocyclopent-2-en-1-ylidene]ethylidene]-1,3,3-trimethyl-5,6-dihydroindole;ethane |
| SMILES | C=CC1=C(C=C)C(C)(C)C(/C=C/C2=C(Cl)/C(=C/C=C3/N(C)C4=CCCC=C4C3(C)C)CC2)=[N+]1C.CC |
| InChI | InChI=1S/C31H38ClN2.C2H6/c1-9-23-25(10-2)33(7)27(30(23,3)4)19-17-21-15-16-22(29(21)32)18-20-28-31(5,6)24-13-11-12-14-26(24)34(28)8;1-2/h9-10,13-14,17-20H,1-2,11-12,15-16H2,3-8H3;1-2H3/q+1; |
| InChIKey | JLDBMQSMATZWRO-UHFFFAOYSA-N |
| XLogP | 8.99 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.18 |
| LogP ≤ 5 | 8.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|