C19H26N4O3 — CID 143493343
2-(3,5-dimethoxyanilino)-N-hexylpyrimidine-4-carboxamide (PubChem CID 143493343) has the molecular formula C19H26N4O3 and a molecular weight of 358.44 g/mol. Its IUPAC name is 2-(3,5-dimethoxyanilino)-N-hexylpyrimidine-4-carboxamide.
| Compound Name | 2-(3,5-dimethoxyanilino)-N-hexylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 143493343 |
| Molecular Formula | C19H26N4O3 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.20 |
| IUPAC Name | 2-(3,5-dimethoxyanilino)-N-hexylpyrimidine-4-carboxamide |
| SMILES | CCCCCCNC(=O)c1ccnc(Nc2cc(OC)cc(OC)c2)n1 |
| InChI | InChI=1S/C19H26N4O3/c1-4-5-6-7-9-20-18(24)17-8-10-21-19(23-17)22-14-11-15(25-2)13-16(12-14)26-3/h8,10-13H,4-7,9H2,1-3H3,(H,20,24)(H,21,22,23) |
| InChIKey | XJTRCNWEJOVSDH-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|