C18H22FN5O3 — CID 143493447
(E)-2,3-diamino-3-[2-amino-3-(2,6-dimethoxy-3-pyridinyl)-4-fluorophenyl]-N-ethylprop-2-enamide (PubChem CID 143493447) has the molecular formula C18H22FN5O3 and a molecular weight of 375.40 g/mol. Its IUPAC name is (E)-2,3-diamino-3-[2-amino-3-(2,6-dimethoxy-3-pyridinyl)-4-fluorophenyl]-N-ethylprop-2-enamide.
| Compound Name | (E)-2,3-diamino-3-[2-amino-3-(2,6-dimethoxy-3-pyridinyl)-4-fluorophenyl]-N-ethylprop-2-enamide |
|---|---|
| PubChem CID | 143493447 |
| Molecular Formula | C18H22FN5O3 |
| Molecular Weight | 375.40 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | (E)-2,3-diamino-3-[2-amino-3-(2,6-dimethoxy-3-pyridinyl)-4-fluorophenyl]-N-ethylprop-2-enamide |
| SMILES | CCNC(=O)/C(N)=C(\N)c1ccc(F)c(-c2ccc(OC)nc2OC)c1N |
| InChI | InChI=1S/C18H22FN5O3/c1-4-23-17(25)16(22)15(21)10-5-7-11(19)13(14(10)20)9-6-8-12(26-2)24-18(9)27-3/h5-8H,4,20-22H2,1-3H3,(H,23,25)/b16-15+ |
| InChIKey | WXEPXIBSFBNHFB-FOCLMDBBSA-N |
| XLogP | 1.21 |
| TPSA | 138.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.40 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|