2-[4,5-dimethyl-3-(trifluoromethyl)pyrazol-1-yl]acetic acid

C8H9F3N2O2 — CID 143493866

IUPAC2-[4,5-dimethyl-3-(trifluoromethyl)pyrazol-1-yl]acetic acid
SMILESCc1c(C(F)(F)F)nn(CC(=O)O)c1C
InChIInChI=1S/C8H9F3N2O2/c1-4-5(2)13(3-6(14)15)12-7(4)8(9,10)11/h3H2,1-2H3,(H,14,15)
InChIKeyOPFKKSLWHYRQIW-UHFFFAOYSA-N
MW222.17 g/mol
LogP1.60
Rot. Bonds2

About 2-[4,5-dimethyl-3-(trifluoromethyl)pyrazol-1-yl]acetic acid

2-[4,5-dimethyl-3-(trifluoromethyl)pyrazol-1-yl]acetic acid (PubChem CID 143493866) has the molecular formula C8H9F3N2O2 and a molecular weight of 222.17 g/mol. Its IUPAC name is 2-[4,5-dimethyl-3-(trifluoromethyl)pyrazol-1-yl]acetic acid.

Molecular Properties

Compound Name2-[4,5-dimethyl-3-(trifluoromethyl)pyrazol-1-yl]acetic acid
PubChem CID143493866
Molecular FormulaC8H9F3N2O2
Molecular Weight222.17 g/mol
Exact Mass222.06
IUPAC Name2-[4,5-dimethyl-3-(trifluoromethyl)pyrazol-1-yl]acetic acid
SMILESCc1c(C(F)(F)F)nn(CC(=O)O)c1C
InChIInChI=1S/C8H9F3N2O2/c1-4-5(2)13(3-6(14)15)12-7(4)8(9,10)11/h3H2,1-2H3,(H,14,15)
InChIKeyOPFKKSLWHYRQIW-UHFFFAOYSA-N
XLogP1.60
TPSA55.12 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500222.17
LogP ≤ 51.60
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-[4,5-dimethyl-3-(trifluoromethyl)pyrazol-1-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[4,5-dimethyl-3-(trifluoromethyl)pyrazol-1-yl]acetic acid?
The IUPAC name of 2-[4,5-dimethyl-3-(trifluoromethyl)pyrazol-1-yl]acetic acid (CID 143493866) is 2-[4,5-dimethyl-3-(trifluoromethyl)pyrazol-1-yl]acetic acid.
What is the SMILES notation for 2-[4,5-dimethyl-3-(trifluoromethyl)pyrazol-1-yl]acetic acid?
The canonical SMILES for 2-[4,5-dimethyl-3-(trifluoromethyl)pyrazol-1-yl]acetic acid is Cc1c(C(F)(F)F)nn(CC(=O)O)c1C.
What is the InChIKey of 2-[4,5-dimethyl-3-(trifluoromethyl)pyrazol-1-yl]acetic acid?
The InChIKey is OPFKKSLWHYRQIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9F3N2O2/c1-4-5(2)13(3-6(14)15)12-7(4)8(9,10)11/h3H2,1-2H3,(H,14,15).
What are the key properties of 2-[4,5-dimethyl-3-(trifluoromethyl)pyrazol-1-yl]acetic acid?
2-[4,5-dimethyl-3-(trifluoromethyl)pyrazol-1-yl]acetic acid has a molecular weight of 222.17 g/mol, XLogP of 1.60, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4,5-dimethyl-3-(trifluoromethyl)pyrazol-1-yl]acetic acid is sourced from PubChem (CID 143493866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).