C27H33N — CID 143494349
N-(4,5-dimethylcyclohexa-1,3-dien-1-yl)-N-(4-methylhex-1-en-3-yl)-4-phenylaniline (PubChem CID 143494349) has the molecular formula C27H33N and a molecular weight of 371.57 g/mol. Its IUPAC name is N-(4,5-dimethylcyclohexa-1,3-dien-1-yl)-N-(4-methylhex-1-en-3-yl)-4-phenylaniline.
| Compound Name | N-(4,5-dimethylcyclohexa-1,3-dien-1-yl)-N-(4-methylhex-1-en-3-yl)-4-phenylaniline |
|---|---|
| PubChem CID | 143494349 |
| Molecular Formula | C27H33N |
| Molecular Weight | 371.57 g/mol |
| Exact Mass | 371.26 |
| IUPAC Name | N-(4,5-dimethylcyclohexa-1,3-dien-1-yl)-N-(4-methylhex-1-en-3-yl)-4-phenylaniline |
| SMILES | C=CC(C(C)CC)N(C1=CC=C(C)C(C)C1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C27H33N/c1-6-20(3)27(7-2)28(26-16-13-21(4)22(5)19-26)25-17-14-24(15-18-25)23-11-9-8-10-12-23/h7-18,20,22,27H,2,6,19H2,1,3-5H3 |
| InChIKey | GUBUNMUIOAQDCZ-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.57 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|