About 3,5-dimethyl-1H-pyrazole;methane;2-methylpropane
3,5-dimethyl-1H-pyrazole;methane;2-methylpropane (PubChem CID 143494654) has the molecular formula C10H22N2
and a molecular weight of 170.30 g/mol. Its IUPAC name is 3,5-dimethyl-1H-pyrazole;methane;2-methylpropane.
Molecular Properties
| Compound Name | 3,5-dimethyl-1H-pyrazole;methane;2-methylpropane |
| PubChem CID | 143494654 |
| Molecular Formula | C10H22N2 |
| Molecular Weight | 170.30 g/mol |
| Exact Mass | 170.18 |
| IUPAC Name | 3,5-dimethyl-1H-pyrazole;methane;2-methylpropane |
| SMILES | C.CC(C)C.Cc1cc(C)[nH]n1 |
| InChI | InChI=1S/C5H8N2.C4H10.CH4/c1-4-3-5(2)7-6-4;1-4(2)3;/h3H,1-2H3,(H,6,7);4H,1-3H3;1H4 |
| InChIKey | RIFNIXUDLCWUJA-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.30 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,5-dimethyl-1H-pyrazole;methane;2-methylpropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dimethyl-1H-pyrazole;methane;2-methylpropane?
The IUPAC name of 3,5-dimethyl-1H-pyrazole;methane;2-methylpropane (CID 143494654) is 3,5-dimethyl-1H-pyrazole;methane;2-methylpropane.
What is the SMILES notation for 3,5-dimethyl-1H-pyrazole;methane;2-methylpropane?
The canonical SMILES for 3,5-dimethyl-1H-pyrazole;methane;2-methylpropane is C.CC(C)C.Cc1cc(C)[nH]n1.
What is the InChIKey of 3,5-dimethyl-1H-pyrazole;methane;2-methylpropane?
The InChIKey is RIFNIXUDLCWUJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N2.C4H10.CH4/c1-4-3-5(2)7-6-4;1-4(2)3;/h3H,1-2H3,(H,6,7);4H,1-3H3;1H4.
What are the key properties of 3,5-dimethyl-1H-pyrazole;methane;2-methylpropane?
3,5-dimethyl-1H-pyrazole;methane;2-methylpropane has a molecular weight of 170.30 g/mol, XLogP of 3.32, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dimethyl-1H-pyrazole;methane;2-methylpropane is sourced from PubChem (CID 143494654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).