C12H22N2 — CID 143494835
(4Z,6Z)-4-ethenyl-1-N,1-N-dimethylocta-4,6-diene-1,2-diamine (PubChem CID 143494835) has the molecular formula C12H22N2 and a molecular weight of 194.32 g/mol. Its IUPAC name is (4Z,6Z)-4-ethenyl-1-N,1-N-dimethylocta-4,6-diene-1,2-diamine.
| Compound Name | (4Z,6Z)-4-ethenyl-1-N,1-N-dimethylocta-4,6-diene-1,2-diamine |
|---|---|
| PubChem CID | 143494835 |
| Molecular Formula | C12H22N2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.18 |
| IUPAC Name | (4Z,6Z)-4-ethenyl-1-N,1-N-dimethylocta-4,6-diene-1,2-diamine |
| SMILES | C=C/C(=C\C=C/C)CC(N)CN(C)C |
| InChI | InChI=1S/C12H22N2/c1-5-7-8-11(6-2)9-12(13)10-14(3)4/h5-8,12H,2,9-10,13H2,1,3-4H3/b7-5-,11-8+ |
| InChIKey | FENDCDQBWCRHCN-UKJSTWFMSA-N |
| XLogP | 1.95 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|