C22H22F2N2OS — CID 143495078
[2-[(2E,4E)-1,5-difluorohepta-2,4,6-trien-3-yl]-1-methyl-4-thiophen-2-ylpyrrol-3-yl]-(1,2-dihydropyridin-5-yl)methanol (PubChem CID 143495078) has the molecular formula C22H22F2N2OS and a molecular weight of 400.49 g/mol. Its IUPAC name is [2-[(2E,4E)-1,5-difluorohepta-2,4,6-trien-3-yl]-1-methyl-4-thiophen-2-ylpyrrol-3-yl]-(1,2-dihydropyridin-5-yl)methanol.
| Compound Name | [2-[(2E,4E)-1,5-difluorohepta-2,4,6-trien-3-yl]-1-methyl-4-thiophen-2-ylpyrrol-3-yl]-(1,2-dihydropyridin-5-yl)methanol |
|---|---|
| PubChem CID | 143495078 |
| Molecular Formula | C22H22F2N2OS |
| Molecular Weight | 400.49 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | [2-[(2E,4E)-1,5-difluorohepta-2,4,6-trien-3-yl]-1-methyl-4-thiophen-2-ylpyrrol-3-yl]-(1,2-dihydropyridin-5-yl)methanol |
| SMILES | C=C/C(F)=C\C(=C/CF)c1c(C(O)C2=CNCC=C2)c(-c2cccs2)cn1C |
| InChI | InChI=1S/C22H22F2N2OS/c1-3-17(24)12-15(8-9-23)21-20(22(27)16-6-4-10-25-13-16)18(14-26(21)2)19-7-5-11-28-19/h3-8,11-14,22,25,27H,1,9-10H2,2H3/b15-8+,17-12+ |
| InChIKey | HVADPIRLVNBQNQ-SZLFEGQVSA-N |
| XLogP | 5.22 |
| TPSA | 37.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.49 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|