C19H30F2O — CID 143495768
(Z,6E,7E)-2,2-difluoro-7-(methoxymethylidene)-6-prop-2-enylidene-8-propylundec-4-ene (PubChem CID 143495768) has the molecular formula C19H30F2O and a molecular weight of 312.44 g/mol. Its IUPAC name is (Z,6E,7E)-2,2-difluoro-7-(methoxymethylidene)-6-prop-2-enylidene-8-propylundec-4-ene.
| Compound Name | (Z,6E,7E)-2,2-difluoro-7-(methoxymethylidene)-6-prop-2-enylidene-8-propylundec-4-ene |
|---|---|
| PubChem CID | 143495768 |
| Molecular Formula | C19H30F2O |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.23 |
| IUPAC Name | (Z,6E,7E)-2,2-difluoro-7-(methoxymethylidene)-6-prop-2-enylidene-8-propylundec-4-ene |
| SMILES | C=C/C=C(\C=C/CC(C)(F)F)C(=C/OC)/C(CCC)CCC |
| InChI | InChI=1S/C19H30F2O/c1-6-10-16(11-7-2)18(15-22-5)17(12-8-3)13-9-14-19(4,20)21/h8-9,12-13,15-16H,3,6-7,10-11,14H2,1-2,4-5H3/b13-9-,17-12+,18-15+ |
| InChIKey | PRRMOXLRQDQTAN-MSPHYWGXSA-N |
| XLogP | 6.45 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|