C11H18FN5 — CID 143495826
5-[[4-(aminomethyl)-4-fluoropiperidin-1-yl]methyl]pyrimidin-2-amine (PubChem CID 143495826) has the molecular formula C11H18FN5 and a molecular weight of 239.30 g/mol. Its IUPAC name is 5-[[4-(aminomethyl)-4-fluoropiperidin-1-yl]methyl]pyrimidin-2-amine.
| Compound Name | 5-[[4-(aminomethyl)-4-fluoropiperidin-1-yl]methyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 143495826 |
| Molecular Formula | C11H18FN5 |
| Molecular Weight | 239.30 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | 5-[[4-(aminomethyl)-4-fluoropiperidin-1-yl]methyl]pyrimidin-2-amine |
| SMILES | NCC1(F)CCN(Cc2cnc(N)nc2)CC1 |
| InChI | InChI=1S/C11H18FN5/c12-11(8-13)1-3-17(4-2-11)7-9-5-15-10(14)16-6-9/h5-6H,1-4,7-8,13H2,(H2,14,15,16) |
| InChIKey | PRJFJMUUDXUSNR-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.30 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |