C24H29F2N2O2P — CID 143495989
(1-benzylpiperidin-4-yl)-[4-(2,6-difluoro-4-phosphanylphenoxy)piperidin-1-yl]methanone (PubChem CID 143495989) has the molecular formula C24H29F2N2O2P and a molecular weight of 446.48 g/mol. Its IUPAC name is (1-benzylpiperidin-4-yl)-[4-(2,6-difluoro-4-phosphanylphenoxy)piperidin-1-yl]methanone.
| Compound Name | (1-benzylpiperidin-4-yl)-[4-(2,6-difluoro-4-phosphanylphenoxy)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 143495989 |
| Molecular Formula | C24H29F2N2O2P |
| Molecular Weight | 446.48 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | (1-benzylpiperidin-4-yl)-[4-(2,6-difluoro-4-phosphanylphenoxy)piperidin-1-yl]methanone |
| SMILES | O=C(C1CCN(Cc2ccccc2)CC1)N1CCC(Oc2c(F)cc(P)cc2F)CC1 |
| InChI | InChI=1S/C24H29F2N2O2P/c25-21-14-20(31)15-22(26)23(21)30-19-8-12-28(13-9-19)24(29)18-6-10-27(11-7-18)16-17-4-2-1-3-5-17/h1-5,14-15,18-19H,6-13,16,31H2 |
| InChIKey | XENHDFYTWUXGJU-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.48 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|