C11H17ClO3 — CID 143496288
(3Z,5Z)-7-chloro-2,3,4-trimethoxy-6-methylhepta-1,3,5-triene (PubChem CID 143496288) has the molecular formula C11H17ClO3 and a molecular weight of 232.71 g/mol. Its IUPAC name is (3Z,5Z)-7-chloro-2,3,4-trimethoxy-6-methylhepta-1,3,5-triene.
| Compound Name | (3Z,5Z)-7-chloro-2,3,4-trimethoxy-6-methylhepta-1,3,5-triene |
|---|---|
| PubChem CID | 143496288 |
| Molecular Formula | C11H17ClO3 |
| Molecular Weight | 232.71 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | (3Z,5Z)-7-chloro-2,3,4-trimethoxy-6-methylhepta-1,3,5-triene |
| SMILES | C=C(OC)/C(OC)=C(\C=C(\C)CCl)OC |
| InChI | InChI=1S/C11H17ClO3/c1-8(7-12)6-10(14-4)11(15-5)9(2)13-3/h6H,2,7H2,1,3-5H3/b8-6-,11-10- |
| InChIKey | IAFAGLJLCSEXBG-CAVDHDHCSA-N |
| XLogP | 2.84 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.71 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|