C14H26N2O3 — CID 143496488
ethane;(3E,5Z)-4-nitrohepta-1,3,5-triene;piperidin-4-ol (PubChem CID 143496488) has the molecular formula C14H26N2O3 and a molecular weight of 270.37 g/mol. Its IUPAC name is ethane;(3E,5Z)-4-nitrohepta-1,3,5-triene;piperidin-4-ol.
| Compound Name | ethane;(3E,5Z)-4-nitrohepta-1,3,5-triene;piperidin-4-ol |
|---|---|
| PubChem CID | 143496488 |
| Molecular Formula | C14H26N2O3 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.19 |
| IUPAC Name | ethane;(3E,5Z)-4-nitrohepta-1,3,5-triene;piperidin-4-ol |
| SMILES | C=C/C=C(\C=C/C)[N+](=O)[O-].CC.OC1CCNCC1 |
| InChI | InChI=1S/C7H9NO2.C5H11NO.C2H6/c1-3-5-7(6-4-2)8(9)10;7-5-1-3-6-4-2-5;1-2/h3-6H,1H2,2H3;5-7H,1-4H2;1-2H3/b6-4-,7-5+;; |
| InChIKey | FCDBESLBHHNKTL-YVCKSLIESA-N |
| XLogP | 2.67 |
| TPSA | 75.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|