C27H33N5O2 — CID 143496568
N-(2,4-dimethylphenyl)formamide;(4-methylpiperazin-1-yl)-[4-[methyl(pyridin-4-yl)amino]phenyl]methanone (PubChem CID 143496568) has the molecular formula C27H33N5O2 and a molecular weight of 459.59 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)formamide;(4-methylpiperazin-1-yl)-[4-[methyl(pyridin-4-yl)amino]phenyl]methanone.
| Compound Name | N-(2,4-dimethylphenyl)formamide;(4-methylpiperazin-1-yl)-[4-[methyl(pyridin-4-yl)amino]phenyl]methanone |
|---|---|
| PubChem CID | 143496568 |
| Molecular Formula | C27H33N5O2 |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.26 |
| IUPAC Name | N-(2,4-dimethylphenyl)formamide;(4-methylpiperazin-1-yl)-[4-[methyl(pyridin-4-yl)amino]phenyl]methanone |
| SMILES | CN1CCN(C(=O)c2ccc(N(C)c3ccncc3)cc2)CC1.Cc1ccc(NC=O)c(C)c1 |
| InChI | InChI=1S/C18H22N4O.C9H11NO/c1-20-11-13-22(14-12-20)18(23)15-3-5-16(6-4-15)21(2)17-7-9-19-10-8-17;1-7-3-4-9(10-6-11)8(2)5-7/h3-10H,11-14H2,1-2H3;3-6H,1-2H3,(H,10,11) |
| InChIKey | BQMTVLJMOWFZSE-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 68.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|