About methane;9-methyl-1-oxaspiro[5.5]undeca-4,9-diene
methane;9-methyl-1-oxaspiro[5.5]undeca-4,9-diene (PubChem CID 143496664) has the molecular formula C12H20O
and a molecular weight of 180.29 g/mol. Its IUPAC name is methane;9-methyl-1-oxaspiro[5.5]undeca-4,9-diene.
Molecular Properties
| Compound Name | methane;9-methyl-1-oxaspiro[5.5]undeca-4,9-diene |
| PubChem CID | 143496664 |
| Molecular Formula | C12H20O |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.15 |
| IUPAC Name | methane;9-methyl-1-oxaspiro[5.5]undeca-4,9-diene |
| SMILES | C.CC1=CCC2(C=CCCO2)CC1 |
| InChI | InChI=1S/C11H16O.CH4/c1-10-4-7-11(8-5-10)6-2-3-9-12-11;/h2,4,6H,3,5,7-9H2,1H3;1H4 |
| InChIKey | OWEIHWCZDYVHFX-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methane;9-methyl-1-oxaspiro[5.5]undeca-4,9-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;9-methyl-1-oxaspiro[5.5]undeca-4,9-diene?
The IUPAC name of methane;9-methyl-1-oxaspiro[5.5]undeca-4,9-diene (CID 143496664) is methane;9-methyl-1-oxaspiro[5.5]undeca-4,9-diene.
What is the SMILES notation for methane;9-methyl-1-oxaspiro[5.5]undeca-4,9-diene?
The canonical SMILES for methane;9-methyl-1-oxaspiro[5.5]undeca-4,9-diene is C.CC1=CCC2(C=CCCO2)CC1.
What is the InChIKey of methane;9-methyl-1-oxaspiro[5.5]undeca-4,9-diene?
The InChIKey is OWEIHWCZDYVHFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O.CH4/c1-10-4-7-11(8-5-10)6-2-3-9-12-11;/h2,4,6H,3,5,7-9H2,1H3;1H4.
What are the key properties of methane;9-methyl-1-oxaspiro[5.5]undeca-4,9-diene?
methane;9-methyl-1-oxaspiro[5.5]undeca-4,9-diene has a molecular weight of 180.29 g/mol, XLogP of 3.47, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for methane;9-methyl-1-oxaspiro[5.5]undeca-4,9-diene is sourced from PubChem (CID 143496664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).