C26H31ClN6OS2 — CID 143497436
5-chloro-1-propylindole;2-methyl-4-[4-(1,2,4-thiadiazol-5-ylamino)sulfanylphenyl]-1,4-diazepane-1-carbaldehyde (PubChem CID 143497436) has the molecular formula C26H31ClN6OS2 and a molecular weight of 543.16 g/mol. Its IUPAC name is 5-chloro-1-propylindole;2-methyl-4-[4-(1,2,4-thiadiazol-5-ylamino)sulfanylphenyl]-1,4-diazepane-1-carbaldehyde.
| Compound Name | 5-chloro-1-propylindole;2-methyl-4-[4-(1,2,4-thiadiazol-5-ylamino)sulfanylphenyl]-1,4-diazepane-1-carbaldehyde |
|---|---|
| PubChem CID | 143497436 |
| Molecular Formula | C26H31ClN6OS2 |
| Molecular Weight | 543.16 g/mol |
| Exact Mass | 542.17 |
| IUPAC Name | 5-chloro-1-propylindole;2-methyl-4-[4-(1,2,4-thiadiazol-5-ylamino)sulfanylphenyl]-1,4-diazepane-1-carbaldehyde |
| SMILES | CC1CN(c2ccc(SNc3ncns3)cc2)CCCN1C=O.CCCn1ccc2cc(Cl)ccc21 |
| InChI | InChI=1S/C15H19N5OS2.C11H12ClN/c1-12-9-19(7-2-8-20(12)11-21)13-3-5-14(6-4-13)22-18-15-16-10-17-23-15;1-2-6-13-7-5-9-8-10(12)3-4-11(9)13/h3-6,10-12H,2,7-9H2,1H3,(H,16,17,18);3-5,7-8H,2,6H2,1H3 |
| InChIKey | NVHFOQUJCLWONZ-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.16 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|