About 3-(aminomethyl)-N-fluoro-5-methylcyclohepta-1,3,6-trien-1-amine
3-(aminomethyl)-N-fluoro-5-methylcyclohepta-1,3,6-trien-1-amine (PubChem CID 143497881) has the molecular formula C9H13FN2
and a molecular weight of 168.21 g/mol. Its IUPAC name is 3-(aminomethyl)-N-fluoro-5-methylcyclohepta-1,3,6-trien-1-amine.
Molecular Properties
| Compound Name | 3-(aminomethyl)-N-fluoro-5-methylcyclohepta-1,3,6-trien-1-amine |
| PubChem CID | 143497881 |
| Molecular Formula | C9H13FN2 |
| Molecular Weight | 168.21 g/mol |
| Exact Mass | 168.11 |
| IUPAC Name | 3-(aminomethyl)-N-fluoro-5-methylcyclohepta-1,3,6-trien-1-amine |
| SMILES | CC1C=CC(NF)=CC(CN)=C1 |
| InChI | InChI=1S/C9H13FN2/c1-7-2-3-9(12-10)5-8(4-7)6-11/h2-5,7,12H,6,11H2,1H3 |
| InChIKey | BMBKMPVBGMOBQX-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.21 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze 3-(aminomethyl)-N-fluoro-5-methylcyclohepta-1,3,6-trien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(aminomethyl)-N-fluoro-5-methylcyclohepta-1,3,6-trien-1-amine?
The IUPAC name of 3-(aminomethyl)-N-fluoro-5-methylcyclohepta-1,3,6-trien-1-amine (CID 143497881) is 3-(aminomethyl)-N-fluoro-5-methylcyclohepta-1,3,6-trien-1-amine.
What is the SMILES notation for 3-(aminomethyl)-N-fluoro-5-methylcyclohepta-1,3,6-trien-1-amine?
The canonical SMILES for 3-(aminomethyl)-N-fluoro-5-methylcyclohepta-1,3,6-trien-1-amine is CC1C=CC(NF)=CC(CN)=C1.
What is the InChIKey of 3-(aminomethyl)-N-fluoro-5-methylcyclohepta-1,3,6-trien-1-amine?
The InChIKey is BMBKMPVBGMOBQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13FN2/c1-7-2-3-9(12-10)5-8(4-7)6-11/h2-5,7,12H,6,11H2,1H3.
What are the key properties of 3-(aminomethyl)-N-fluoro-5-methylcyclohepta-1,3,6-trien-1-amine?
3-(aminomethyl)-N-fluoro-5-methylcyclohepta-1,3,6-trien-1-amine has a molecular weight of 168.21 g/mol, XLogP of 1.44, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(aminomethyl)-N-fluoro-5-methylcyclohepta-1,3,6-trien-1-amine is sourced from PubChem (CID 143497881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).