C25H31N3O — CID 143498217
5-[1-[(6Z,8Z)-5-methylidenedeca-1,6,8-trien-2-yl]piperidin-3-yl]-3-(4-methylphenyl)-1,2,4-oxadiazole (PubChem CID 143498217) has the molecular formula C25H31N3O and a molecular weight of 389.54 g/mol. Its IUPAC name is 5-[1-[(6Z,8Z)-5-methylidenedeca-1,6,8-trien-2-yl]piperidin-3-yl]-3-(4-methylphenyl)-1,2,4-oxadiazole.
| Compound Name | 5-[1-[(6Z,8Z)-5-methylidenedeca-1,6,8-trien-2-yl]piperidin-3-yl]-3-(4-methylphenyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 143498217 |
| Molecular Formula | C25H31N3O |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.25 |
| IUPAC Name | 5-[1-[(6Z,8Z)-5-methylidenedeca-1,6,8-trien-2-yl]piperidin-3-yl]-3-(4-methylphenyl)-1,2,4-oxadiazole |
| SMILES | C=C(/C=C\C=C/C)CCC(=C)N1CCCC(c2nc(-c3ccc(C)cc3)no2)C1 |
| InChI | InChI=1S/C25H31N3O/c1-5-6-7-9-19(2)11-14-21(4)28-17-8-10-23(18-28)25-26-24(27-29-25)22-15-12-20(3)13-16-22/h5-7,9,12-13,15-16,23H,2,4,8,10-11,14,17-18H2,1,3H3/b6-5-,9-7- |
| InChIKey | UCNVVXHYJZZSSG-LZWBOMALSA-N |
| XLogP | 6.21 |
| TPSA | 42.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|