About 3-methoxy-N,N-dimethylcyclohexa-2,4-diene-1-carboxamide
3-methoxy-N,N-dimethylcyclohexa-2,4-diene-1-carboxamide (PubChem CID 143498323) has the molecular formula C10H15NO2
and a molecular weight of 181.23 g/mol. Its IUPAC name is 3-methoxy-N,N-dimethylcyclohexa-2,4-diene-1-carboxamide.
Molecular Properties
| Compound Name | 3-methoxy-N,N-dimethylcyclohexa-2,4-diene-1-carboxamide |
| PubChem CID | 143498323 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | 3-methoxy-N,N-dimethylcyclohexa-2,4-diene-1-carboxamide |
| SMILES | COC1=CC(C(=O)N(C)C)CC=C1 |
| InChI | InChI=1S/C10H15NO2/c1-11(2)10(12)8-5-4-6-9(7-8)13-3/h4,6-8H,5H2,1-3H3 |
| InChIKey | ITEMDEUKTHQWAC-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methoxy-N,N-dimethylcyclohexa-2,4-diene-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxy-N,N-dimethylcyclohexa-2,4-diene-1-carboxamide?
The IUPAC name of 3-methoxy-N,N-dimethylcyclohexa-2,4-diene-1-carboxamide (CID 143498323) is 3-methoxy-N,N-dimethylcyclohexa-2,4-diene-1-carboxamide.
What is the SMILES notation for 3-methoxy-N,N-dimethylcyclohexa-2,4-diene-1-carboxamide?
The canonical SMILES for 3-methoxy-N,N-dimethylcyclohexa-2,4-diene-1-carboxamide is COC1=CC(C(=O)N(C)C)CC=C1.
What is the InChIKey of 3-methoxy-N,N-dimethylcyclohexa-2,4-diene-1-carboxamide?
The InChIKey is ITEMDEUKTHQWAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO2/c1-11(2)10(12)8-5-4-6-9(7-8)13-3/h4,6-8H,5H2,1-3H3.
What are the key properties of 3-methoxy-N,N-dimethylcyclohexa-2,4-diene-1-carboxamide?
3-methoxy-N,N-dimethylcyclohexa-2,4-diene-1-carboxamide has a molecular weight of 181.23 g/mol, XLogP of 1.18, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxy-N,N-dimethylcyclohexa-2,4-diene-1-carboxamide is sourced from PubChem (CID 143498323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).