C10H13FN2O — CID 143498394
3-(5-fluorocyclohepta-1,4,6-trien-1-yl)-1,1-dimethylurea (PubChem CID 143498394) has the molecular formula C10H13FN2O and a molecular weight of 196.22 g/mol. Its IUPAC name is 3-(5-fluorocyclohepta-1,4,6-trien-1-yl)-1,1-dimethylurea.
| Compound Name | 3-(5-fluorocyclohepta-1,4,6-trien-1-yl)-1,1-dimethylurea |
|---|---|
| PubChem CID | 143498394 |
| Molecular Formula | C10H13FN2O |
| Molecular Weight | 196.22 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | 3-(5-fluorocyclohepta-1,4,6-trien-1-yl)-1,1-dimethylurea |
| SMILES | CN(C)C(=O)NC1=CCC=C(F)C=C1 |
| InChI | InChI=1S/C10H13FN2O/c1-13(2)10(14)12-9-5-3-4-8(11)6-7-9/h4-7H,3H2,1-2H3,(H,12,14) |
| InChIKey | JGCVSHCQNLFWAC-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.22 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |