C10H17NS — CID 143498483
ethane;(3Z,5Z)-4-(methylideneamino)hepta-1,3,5-triene-3-thiol (PubChem CID 143498483) has the molecular formula C10H17NS and a molecular weight of 183.32 g/mol. Its IUPAC name is ethane;(3Z,5Z)-4-(methylideneamino)hepta-1,3,5-triene-3-thiol.
| Compound Name | ethane;(3Z,5Z)-4-(methylideneamino)hepta-1,3,5-triene-3-thiol |
|---|---|
| PubChem CID | 143498483 |
| Molecular Formula | C10H17NS |
| Molecular Weight | 183.32 g/mol |
| Exact Mass | 183.11 |
| IUPAC Name | ethane;(3Z,5Z)-4-(methylideneamino)hepta-1,3,5-triene-3-thiol |
| SMILES | C=C/C(S)=C(\C=C/C)N=C.CC |
| InChI | InChI=1S/C8H11NS.C2H6/c1-4-6-7(9-3)8(10)5-2;1-2/h4-6,10H,2-3H2,1H3;1-2H3/b6-4-,8-7-; |
| InChIKey | GNIKVHBAGHVTMD-VSZQJPAFSA-N |
| XLogP | 3.62 |
| TPSA | 12.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.32 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|