C34H36Cl2N8O5 — CID 14350007
4-[4-[4-[4-[[2-(2,4-dichlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-2-(1-methoxyethyl)-1,2,4-triazol-3-one (PubChem CID 14350007) has the molecular formula C34H36Cl2N8O5 and a molecular weight of 707.62 g/mol. Its IUPAC name is 4-[4-[4-[4-[[2-(2,4-dichlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-2-(1-methoxyethyl)-1,2,4-triazol-3-one.
| Compound Name | 4-[4-[4-[4-[[2-(2,4-dichlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-2-(1-methoxyethyl)-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 14350007 |
| Molecular Formula | C34H36Cl2N8O5 |
| Molecular Weight | 707.62 g/mol |
| Exact Mass | 706.22 |
| IUPAC Name | 4-[4-[4-[4-[[2-(2,4-dichlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-2-(1-methoxyethyl)-1,2,4-triazol-3-one |
| SMILES | COC(C)n1ncn(-c2ccc(N3CCN(c4ccc(OCC5COC(Cn6cncn6)(c6ccc(Cl)cc6Cl)O5)cc4)CC3)cc2)c1=O |
| InChI | InChI=1S/C34H36Cl2N8O5/c1-24(46-2)44-33(45)43(23-39-44)28-6-4-26(5-7-28)40-13-15-41(16-14-40)27-8-10-29(11-9-27)47-18-30-19-48-34(49-30,20-42-22-37-21-38-42)31-12-3-25(35)17-32(31)36/h3-12,17,21-24,30H,13-16,18-20H2,1-2H3 |
| InChIKey | CUHCTZATLSNQBF-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 113.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.62 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|