About 5,5-dimethyl-2,3-dihydrocyclohepta[c]pyrrole-1-thione;ethane
5,5-dimethyl-2,3-dihydrocyclohepta[c]pyrrole-1-thione;ethane (PubChem CID 143500190) has the molecular formula C13H19NS
and a molecular weight of 221.37 g/mol. Its IUPAC name is 5,5-dimethyl-2,3-dihydrocyclohepta[c]pyrrole-1-thione;ethane.
Molecular Properties
| Compound Name | 5,5-dimethyl-2,3-dihydrocyclohepta[c]pyrrole-1-thione;ethane |
| PubChem CID | 143500190 |
| Molecular Formula | C13H19NS |
| Molecular Weight | 221.37 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | 5,5-dimethyl-2,3-dihydrocyclohepta[c]pyrrole-1-thione;ethane |
| SMILES | CC.CC1(C)C=CC=C2C(=S)NCC2=C1 |
| InChI | InChI=1S/C11H13NS.C2H6/c1-11(2)5-3-4-9-8(6-11)7-12-10(9)13;1-2/h3-6H,7H2,1-2H3,(H,12,13);1-2H3 |
| InChIKey | OEAZKEQBQAHHFD-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.37 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 5,5-dimethyl-2,3-dihydrocyclohepta[c]pyrrole-1-thione;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-dimethyl-2,3-dihydrocyclohepta[c]pyrrole-1-thione;ethane?
The IUPAC name of 5,5-dimethyl-2,3-dihydrocyclohepta[c]pyrrole-1-thione;ethane (CID 143500190) is 5,5-dimethyl-2,3-dihydrocyclohepta[c]pyrrole-1-thione;ethane.
What is the SMILES notation for 5,5-dimethyl-2,3-dihydrocyclohepta[c]pyrrole-1-thione;ethane?
The canonical SMILES for 5,5-dimethyl-2,3-dihydrocyclohepta[c]pyrrole-1-thione;ethane is CC.CC1(C)C=CC=C2C(=S)NCC2=C1.
What is the InChIKey of 5,5-dimethyl-2,3-dihydrocyclohepta[c]pyrrole-1-thione;ethane?
The InChIKey is OEAZKEQBQAHHFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NS.C2H6/c1-11(2)5-3-4-9-8(6-11)7-12-10(9)13;1-2/h3-6H,7H2,1-2H3,(H,12,13);1-2H3.
What are the key properties of 5,5-dimethyl-2,3-dihydrocyclohepta[c]pyrrole-1-thione;ethane?
5,5-dimethyl-2,3-dihydrocyclohepta[c]pyrrole-1-thione;ethane has a molecular weight of 221.37 g/mol, XLogP of 3.39, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-dimethyl-2,3-dihydrocyclohepta[c]pyrrole-1-thione;ethane is sourced from PubChem (CID 143500190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).