C10H17NS — CID 143500302
ethane;5-methyl-2,3,5,6-tetrahydro-1,3-benzothiazole (PubChem CID 143500302) has the molecular formula C10H17NS and a molecular weight of 183.32 g/mol. Its IUPAC name is ethane;5-methyl-2,3,5,6-tetrahydro-1,3-benzothiazole.
| Compound Name | ethane;5-methyl-2,3,5,6-tetrahydro-1,3-benzothiazole |
|---|---|
| PubChem CID | 143500302 |
| Molecular Formula | C10H17NS |
| Molecular Weight | 183.32 g/mol |
| Exact Mass | 183.11 |
| IUPAC Name | ethane;5-methyl-2,3,5,6-tetrahydro-1,3-benzothiazole |
| SMILES | CC.CC1C=C2NCSC2=CC1 |
| InChI | InChI=1S/C8H11NS.C2H6/c1-6-2-3-8-7(4-6)9-5-10-8;1-2/h3-4,6,9H,2,5H2,1H3;1-2H3 |
| InChIKey | QHQPYSCCPAUTHT-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.32 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |