About methane;7-methoxy-3-oxa-7-azabicyclo[3.3.1]nonane-2,4-dione
methane;7-methoxy-3-oxa-7-azabicyclo[3.3.1]nonane-2,4-dione (PubChem CID 143500316) has the molecular formula C9H15NO4
and a molecular weight of 201.22 g/mol. Its IUPAC name is methane;7-methoxy-3-oxa-7-azabicyclo[3.3.1]nonane-2,4-dione.
Molecular Properties
| Compound Name | methane;7-methoxy-3-oxa-7-azabicyclo[3.3.1]nonane-2,4-dione |
| PubChem CID | 143500316 |
| Molecular Formula | C9H15NO4 |
| Molecular Weight | 201.22 g/mol |
| Exact Mass | 201.10 |
| IUPAC Name | methane;7-methoxy-3-oxa-7-azabicyclo[3.3.1]nonane-2,4-dione |
| SMILES | C.CON1CC2CC(C1)C(=O)OC2=O |
| InChI | InChI=1S/C8H11NO4.CH4/c1-12-9-3-5-2-6(4-9)8(11)13-7(5)10;/h5-6H,2-4H2,1H3;1H4 |
| InChIKey | YIDSFUWGXVEMHZ-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.22 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze methane;7-methoxy-3-oxa-7-azabicyclo[3.3.1]nonane-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;7-methoxy-3-oxa-7-azabicyclo[3.3.1]nonane-2,4-dione?
The IUPAC name of methane;7-methoxy-3-oxa-7-azabicyclo[3.3.1]nonane-2,4-dione (CID 143500316) is methane;7-methoxy-3-oxa-7-azabicyclo[3.3.1]nonane-2,4-dione.
What is the SMILES notation for methane;7-methoxy-3-oxa-7-azabicyclo[3.3.1]nonane-2,4-dione?
The canonical SMILES for methane;7-methoxy-3-oxa-7-azabicyclo[3.3.1]nonane-2,4-dione is C.CON1CC2CC(C1)C(=O)OC2=O.
What is the InChIKey of methane;7-methoxy-3-oxa-7-azabicyclo[3.3.1]nonane-2,4-dione?
The InChIKey is YIDSFUWGXVEMHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO4.CH4/c1-12-9-3-5-2-6(4-9)8(11)13-7(5)10;/h5-6H,2-4H2,1H3;1H4.
What are the key properties of methane;7-methoxy-3-oxa-7-azabicyclo[3.3.1]nonane-2,4-dione?
methane;7-methoxy-3-oxa-7-azabicyclo[3.3.1]nonane-2,4-dione has a molecular weight of 201.22 g/mol, XLogP of 0.21, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methane;7-methoxy-3-oxa-7-azabicyclo[3.3.1]nonane-2,4-dione is sourced from PubChem (CID 143500316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).