C27H31N3O2 — CID 143500957
N-[[3-[(1S)-3-(methylamino)cycloheptyl]oxyphenyl]methyl]-5-phenylpyridine-2-carboxamide (PubChem CID 143500957) has the molecular formula C27H31N3O2 and a molecular weight of 429.56 g/mol. Its IUPAC name is N-[[3-[(1S)-3-(methylamino)cycloheptyl]oxyphenyl]methyl]-5-phenylpyridine-2-carboxamide.
| Compound Name | N-[[3-[(1S)-3-(methylamino)cycloheptyl]oxyphenyl]methyl]-5-phenylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 143500957 |
| Molecular Formula | C27H31N3O2 |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.24 |
| IUPAC Name | N-[[3-[(1S)-3-(methylamino)cycloheptyl]oxyphenyl]methyl]-5-phenylpyridine-2-carboxamide |
| SMILES | CNC1CCCC[C@H](Oc2cccc(CNC(=O)c3ccc(-c4ccccc4)cn3)c2)C1 |
| InChI | InChI=1S/C27H31N3O2/c1-28-23-11-5-6-12-25(17-23)32-24-13-7-8-20(16-24)18-30-27(31)26-15-14-22(19-29-26)21-9-3-2-4-10-21/h2-4,7-10,13-16,19,23,25,28H,5-6,11-12,17-18H2,1H3,(H,30,31)/t23?,25-/m0/s1 |
| InChIKey | MVZIAKVBWSOGDY-YNMFNDETSA-N |
| XLogP | 4.98 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |