C37H38N6O4 — CID 143501045
N-[2-[2-[3-[1-(1,3-dioxobenzo[de]isoquinolin-2-yl)propan-2-yl-methylamino]propyl-methylamino]ethyl]-1,3-dioxobenzo[de]isoquinolin-6-yl]-N-ethenylmethanimidamide (PubChem CID 143501045) has the molecular formula C37H38N6O4 and a molecular weight of 630.75 g/mol. Its IUPAC name is N-[2-[2-[3-[1-(1,3-dioxobenzo[de]isoquinolin-2-yl)propan-2-yl-methylamino]propyl-methylamino]ethyl]-1,3-dioxobenzo[de]isoquinolin-6-yl]-N-ethenylmethanimidamide.
| Compound Name | N-[2-[2-[3-[1-(1,3-dioxobenzo[de]isoquinolin-2-yl)propan-2-yl-methylamino]propyl-methylamino]ethyl]-1,3-dioxobenzo[de]isoquinolin-6-yl]-N-ethenylmethanimidamide |
|---|---|
| PubChem CID | 143501045 |
| Molecular Formula | C37H38N6O4 |
| Molecular Weight | 630.75 g/mol |
| Exact Mass | 630.30 |
| IUPAC Name | N-[2-[2-[3-[1-(1,3-dioxobenzo[de]isoquinolin-2-yl)propan-2-yl-methylamino]propyl-methylamino]ethyl]-1,3-dioxobenzo[de]isoquinolin-6-yl]-N-ethenylmethanimidamide |
| SMILES | [H]/N=C/N(C=C)c1ccc2c3c(cccc13)C(=O)N(CCN(C)CCCN(C)C(C)CN1C(=O)c3cccc4cccc(c34)C1=O)C2=O |
| InChI | InChI=1S/C37H38N6O4/c1-5-41(23-38)31-17-16-30-33-26(31)12-8-15-29(33)34(44)42(35(30)45)21-20-39(3)18-9-19-40(4)24(2)22-43-36(46)27-13-6-10-25-11-7-14-28(32(25)27)37(43)47/h5-8,10-17,23-24,38H,1,9,18-22H2,2-4H3/b38-23+ |
| InChIKey | XLJVJYXNBACSSF-FNTLCPBMSA-N |
| XLogP | 5.08 |
| TPSA | 108.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.75 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|