C14H20BFO3 — CID 143501335
2-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-5-fluorobenzaldehyde;ethane (PubChem CID 143501335) has the molecular formula C14H20BFO3 and a molecular weight of 266.12 g/mol. Its IUPAC name is 2-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-5-fluorobenzaldehyde;ethane.
| Compound Name | 2-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-5-fluorobenzaldehyde;ethane |
|---|---|
| PubChem CID | 143501335 |
| Molecular Formula | C14H20BFO3 |
| Molecular Weight | 266.12 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 2-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-5-fluorobenzaldehyde;ethane |
| SMILES | CC.CC1(C)COB(c2ccc(F)cc2C=O)OC1 |
| InChI | InChI=1S/C12H14BFO3.C2H6/c1-12(2)7-16-13(17-8-12)11-4-3-10(14)5-9(11)6-15;1-2/h3-6H,7-8H2,1-2H3;1-2H3 |
| InChIKey | RXZPGMHBUGTYIW-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.12 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|