C21H31NO2 — CID 143501465
ethane;5-[(2E,4Z)-2-ethylhexa-2,4-dienyl]-3-[(4-methylphenyl)methyl]-1,3-oxazolidin-2-one (PubChem CID 143501465) has the molecular formula C21H31NO2 and a molecular weight of 329.48 g/mol. Its IUPAC name is ethane;5-[(2E,4Z)-2-ethylhexa-2,4-dienyl]-3-[(4-methylphenyl)methyl]-1,3-oxazolidin-2-one.
| Compound Name | ethane;5-[(2E,4Z)-2-ethylhexa-2,4-dienyl]-3-[(4-methylphenyl)methyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 143501465 |
| Molecular Formula | C21H31NO2 |
| Molecular Weight | 329.48 g/mol |
| Exact Mass | 329.24 |
| IUPAC Name | ethane;5-[(2E,4Z)-2-ethylhexa-2,4-dienyl]-3-[(4-methylphenyl)methyl]-1,3-oxazolidin-2-one |
| SMILES | C/C=C\C=C(/CC)CC1CN(Cc2ccc(C)cc2)C(=O)O1.CC |
| InChI | InChI=1S/C19H25NO2.C2H6/c1-4-6-7-16(5-2)12-18-14-20(19(21)22-18)13-17-10-8-15(3)9-11-17;1-2/h4,6-11,18H,5,12-14H2,1-3H3;1-2H3/b6-4-,16-7+; |
| InChIKey | AYDMXAOTNOKDLL-NQZIZBRXSA-N |
| XLogP | 5.64 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.48 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|