C17H18Cl2F3NO3 — CID 143501579
5-[(1S)-3,4-dichlorocyclohexyl]-3-[[4-(trifluoromethoxy)phenyl]methyl]-1,3-oxazolidin-2-one (PubChem CID 143501579) has the molecular formula C17H18Cl2F3NO3 and a molecular weight of 412.24 g/mol. Its IUPAC name is 5-[(1S)-3,4-dichlorocyclohexyl]-3-[[4-(trifluoromethoxy)phenyl]methyl]-1,3-oxazolidin-2-one.
| Compound Name | 5-[(1S)-3,4-dichlorocyclohexyl]-3-[[4-(trifluoromethoxy)phenyl]methyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 143501579 |
| Molecular Formula | C17H18Cl2F3NO3 |
| Molecular Weight | 412.24 g/mol |
| Exact Mass | 411.06 |
| IUPAC Name | 5-[(1S)-3,4-dichlorocyclohexyl]-3-[[4-(trifluoromethoxy)phenyl]methyl]-1,3-oxazolidin-2-one |
| SMILES | O=C1OC([C@H]2CCC(Cl)C(Cl)C2)CN1Cc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C17H18Cl2F3NO3/c18-13-6-3-11(7-14(13)19)15-9-23(16(24)25-15)8-10-1-4-12(5-2-10)26-17(20,21)22/h1-2,4-5,11,13-15H,3,6-9H2/t11-,13?,14?,15?/m0/s1 |
| InChIKey | JPGWFRJQYYBZFL-WXPVAWKNSA-N |
| XLogP | 4.92 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.24 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|