About (1E)-1-(methylideneamino)-2-(methylsulfanylmethyl)buta-1,3-dien-1-amine
(1E)-1-(methylideneamino)-2-(methylsulfanylmethyl)buta-1,3-dien-1-amine (PubChem CID 143501917) has the molecular formula C7H12N2S
and a molecular weight of 156.25 g/mol. Its IUPAC name is (1E)-1-(methylideneamino)-2-(methylsulfanylmethyl)buta-1,3-dien-1-amine.
Molecular Properties
| Compound Name | (1E)-1-(methylideneamino)-2-(methylsulfanylmethyl)buta-1,3-dien-1-amine |
| PubChem CID | 143501917 |
| Molecular Formula | C7H12N2S |
| Molecular Weight | 156.25 g/mol |
| Exact Mass | 156.07 |
| IUPAC Name | (1E)-1-(methylideneamino)-2-(methylsulfanylmethyl)buta-1,3-dien-1-amine |
| SMILES | C=C/C(CSC)=C(/N)N=C |
| InChI | InChI=1S/C7H12N2S/c1-4-6(5-10-3)7(8)9-2/h4H,1-2,5,8H2,3H3/b7-6+ |
| InChIKey | IBISQCJPMAVWIG-VOTSOKGWSA-N |
| XLogP | 1.41 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.25 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (1E)-1-(methylideneamino)-2-(methylsulfanylmethyl)buta-1,3-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1E)-1-(methylideneamino)-2-(methylsulfanylmethyl)buta-1,3-dien-1-amine?
The IUPAC name of (1E)-1-(methylideneamino)-2-(methylsulfanylmethyl)buta-1,3-dien-1-amine (CID 143501917) is (1E)-1-(methylideneamino)-2-(methylsulfanylmethyl)buta-1,3-dien-1-amine.
What is the SMILES notation for (1E)-1-(methylideneamino)-2-(methylsulfanylmethyl)buta-1,3-dien-1-amine?
The canonical SMILES for (1E)-1-(methylideneamino)-2-(methylsulfanylmethyl)buta-1,3-dien-1-amine is C=C/C(CSC)=C(/N)N=C.
What is the InChIKey of (1E)-1-(methylideneamino)-2-(methylsulfanylmethyl)buta-1,3-dien-1-amine?
The InChIKey is IBISQCJPMAVWIG-VOTSOKGWSA-N. The full InChI is InChI=1S/C7H12N2S/c1-4-6(5-10-3)7(8)9-2/h4H,1-2,5,8H2,3H3/b7-6+.
What are the key properties of (1E)-1-(methylideneamino)-2-(methylsulfanylmethyl)buta-1,3-dien-1-amine?
(1E)-1-(methylideneamino)-2-(methylsulfanylmethyl)buta-1,3-dien-1-amine has a molecular weight of 156.25 g/mol, XLogP of 1.41, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1E)-1-(methylideneamino)-2-(methylsulfanylmethyl)buta-1,3-dien-1-amine is sourced from PubChem (CID 143501917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).