C11H16FNO — CID 143502173
N-[(3Z,5E)-3-fluoro-6-methylocta-1,3,5-trien-4-yl]acetamide (PubChem CID 143502173) has the molecular formula C11H16FNO and a molecular weight of 197.25 g/mol. Its IUPAC name is N-[(3Z,5E)-3-fluoro-6-methylocta-1,3,5-trien-4-yl]acetamide.
| Compound Name | N-[(3Z,5E)-3-fluoro-6-methylocta-1,3,5-trien-4-yl]acetamide |
|---|---|
| PubChem CID | 143502173 |
| Molecular Formula | C11H16FNO |
| Molecular Weight | 197.25 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | N-[(3Z,5E)-3-fluoro-6-methylocta-1,3,5-trien-4-yl]acetamide |
| SMILES | C=C/C(F)=C(\C=C(/C)CC)NC(C)=O |
| InChI | InChI=1S/C11H16FNO/c1-5-8(3)7-11(10(12)6-2)13-9(4)14/h6-7H,2,5H2,1,3-4H3,(H,13,14)/b8-7+,11-10- |
| InChIKey | QTKPAWLKTHUKQR-LFOHPMNASA-N |
| XLogP | 2.85 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.25 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|