C18H32FNO — CID 143502422
N-ethyl-4-[(3E,5Z)-7-fluorohepta-1,3,5-trien-4-yl]oxy-N-propylhexan-1-amine (PubChem CID 143502422) has the molecular formula C18H32FNO and a molecular weight of 297.46 g/mol. Its IUPAC name is N-ethyl-4-[(3E,5Z)-7-fluorohepta-1,3,5-trien-4-yl]oxy-N-propylhexan-1-amine.
| Compound Name | N-ethyl-4-[(3E,5Z)-7-fluorohepta-1,3,5-trien-4-yl]oxy-N-propylhexan-1-amine |
|---|---|
| PubChem CID | 143502422 |
| Molecular Formula | C18H32FNO |
| Molecular Weight | 297.46 g/mol |
| Exact Mass | 297.25 |
| IUPAC Name | N-ethyl-4-[(3E,5Z)-7-fluorohepta-1,3,5-trien-4-yl]oxy-N-propylhexan-1-amine |
| SMILES | C=C/C=C(\C=C/CF)OC(CC)CCCN(CC)CCC |
| InChI | InChI=1S/C18H32FNO/c1-5-11-18(12-9-14-19)21-17(7-3)13-10-16-20(8-4)15-6-2/h5,9,11-12,17H,1,6-8,10,13-16H2,2-4H3/b12-9-,18-11+ |
| InChIKey | YAYCXLWNJIOCQF-QBQLSDBTSA-N |
| XLogP | 4.89 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.46 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|