C30H39NO2 — CID 143502598
(E)-7-methyl-3-(7-methylcyclohepta-1,3,5,6-tetraen-1-yl)-8-[4-(5-methylcyclohepta-1,4,6-trien-1-yl)oxypiperidin-1-yl]oct-3-en-2-one (PubChem CID 143502598) has the molecular formula C30H39NO2 and a molecular weight of 445.65 g/mol. Its IUPAC name is (E)-7-methyl-3-(7-methylcyclohepta-1,3,5,6-tetraen-1-yl)-8-[4-(5-methylcyclohepta-1,4,6-trien-1-yl)oxypiperidin-1-yl]oct-3-en-2-one.
| Compound Name | (E)-7-methyl-3-(7-methylcyclohepta-1,3,5,6-tetraen-1-yl)-8-[4-(5-methylcyclohepta-1,4,6-trien-1-yl)oxypiperidin-1-yl]oct-3-en-2-one |
|---|---|
| PubChem CID | 143502598 |
| Molecular Formula | C30H39NO2 |
| Molecular Weight | 445.65 g/mol |
| Exact Mass | 445.30 |
| IUPAC Name | (E)-7-methyl-3-(7-methylcyclohepta-1,3,5,6-tetraen-1-yl)-8-[4-(5-methylcyclohepta-1,4,6-trien-1-yl)oxypiperidin-1-yl]oct-3-en-2-one |
| SMILES | CC(=O)/C(=C/CCC(C)CN1CCC(OC2=CCC=C(C)C=C2)CC1)C1=CC=CC=C=C1C |
| InChI | InChI=1S/C30H39NO2/c1-23-10-8-13-27(17-16-23)33-28-18-20-31(21-19-28)22-24(2)11-9-15-30(26(4)32)29-14-7-5-6-12-25(29)3/h5-7,10,13-17,24,28H,8-9,11,18-22H2,1-4H3/b30-15- |
| InChIKey | JPLODNMGZXQSEW-MNDYBZJGSA-N |
| XLogP | 6.79 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.65 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|